C23H27N3O7S — CID 92695130
ethyl 2-[4-[(3S)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-nitrophenyl]sulfonylacetate (PubChem CID 92695130) has the molecular formula C23H27N3O7S and a molecular weight of 489.55 g/mol. Its IUPAC name is ethyl 2-[4-[(3S)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-nitrophenyl]sulfonylacetate.
| Compound Name | ethyl 2-[4-[(3S)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-nitrophenyl]sulfonylacetate |
|---|---|
| PubChem CID | 92695130 |
| Molecular Formula | C23H27N3O7S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | ethyl 2-[4-[(3S)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-nitrophenyl]sulfonylacetate |
| SMILES | CCOC(=O)CS(=O)(=O)c1ccc(C(=O)N2CCN(c3cccc(C)c3)[C@@H](C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H27N3O7S/c1-4-33-22(27)15-34(31,32)21-9-8-18(13-20(21)26(29)30)23(28)24-10-11-25(17(3)14-24)19-7-5-6-16(2)12-19/h5-9,12-13,17H,4,10-11,14-15H2,1-3H3/t17-/m0/s1 |
| InChIKey | NBYWOXLYKCCYFJ-KRWDZBQOSA-N |
| XLogP | 2.59 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|