C24H28ClN3O6S — CID 156760321
butan-2-yl 2-[4-[(3R)-4-(3-chlorophenyl)-3-methylpiperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate (PubChem CID 156760321) has the molecular formula C24H28ClN3O6S and a molecular weight of 522.02 g/mol. Its IUPAC name is butan-2-yl 2-[4-[(3R)-4-(3-chlorophenyl)-3-methylpiperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate.
| Compound Name | butan-2-yl 2-[4-[(3R)-4-(3-chlorophenyl)-3-methylpiperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate |
|---|---|
| PubChem CID | 156760321 |
| Molecular Formula | C24H28ClN3O6S |
| Molecular Weight | 522.02 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | butan-2-yl 2-[4-[(3R)-4-(3-chlorophenyl)-3-methylpiperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate |
| SMILES | CCC(C)OC(=O)CS(=O)c1ccc(C(=O)N2CCN(c3cccc(Cl)c3)[C@H](C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H28ClN3O6S/c1-4-17(3)34-23(29)15-35(33)22-9-8-18(12-21(22)28(31)32)24(30)26-10-11-27(16(2)14-26)20-7-5-6-19(25)13-20/h5-9,12-13,16-17H,4,10-11,14-15H2,1-3H3/t16-,17?,35?/m1/s1 |
| InChIKey | PGLFYOYWFPMBOP-COTUPUOWSA-N |
| XLogP | 4.05 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.02 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|