C22H24ClN3O6S — CID 156760396
ethyl 2-[4-[(3S)-4-(3-chlorophenyl)-3-methylpiperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate (PubChem CID 156760396) has the molecular formula C22H24ClN3O6S and a molecular weight of 493.97 g/mol. Its IUPAC name is ethyl 2-[4-[(3S)-4-(3-chlorophenyl)-3-methylpiperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate.
| Compound Name | ethyl 2-[4-[(3S)-4-(3-chlorophenyl)-3-methylpiperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate |
|---|---|
| PubChem CID | 156760396 |
| Molecular Formula | C22H24ClN3O6S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | ethyl 2-[4-[(3S)-4-(3-chlorophenyl)-3-methylpiperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate |
| SMILES | CCOC(=O)CS(=O)c1ccc(C(=O)N2CCN(c3cccc(Cl)c3)[C@@H](C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24ClN3O6S/c1-3-32-21(27)14-33(31)20-8-7-16(11-19(20)26(29)30)22(28)24-9-10-25(15(2)13-24)18-6-4-5-17(23)12-18/h4-8,11-12,15H,3,9-10,13-14H2,1-2H3/t15-,33?/m0/s1 |
| InChIKey | CFBFCDUHXHPLKU-CSRAAECXSA-N |
| XLogP | 3.27 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|