C21H22BrN3O6S — CID 156760383
ethyl 2-[4-[4-(4-bromophenyl)piperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate (PubChem CID 156760383) has the molecular formula C21H22BrN3O6S and a molecular weight of 524.39 g/mol. Its IUPAC name is ethyl 2-[4-[4-(4-bromophenyl)piperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate.
| Compound Name | ethyl 2-[4-[4-(4-bromophenyl)piperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate |
|---|---|
| PubChem CID | 156760383 |
| Molecular Formula | C21H22BrN3O6S |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | ethyl 2-[4-[4-(4-bromophenyl)piperazine-1-carbonyl]-2-nitrophenyl]sulfinylacetate |
| SMILES | CCOC(=O)CS(=O)c1ccc(C(=O)N2CCN(c3ccc(Br)cc3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22BrN3O6S/c1-2-31-20(26)14-32(30)19-8-3-15(13-18(19)25(28)29)21(27)24-11-9-23(10-12-24)17-6-4-16(22)5-7-17/h3-8,13H,2,9-12,14H2,1H3 |
| InChIKey | BQOGZOVIZUPOMG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|