C12H14N2O8S — CID 3549748
2-ethoxyethyl 2-(2,4-dinitrophenyl)sulfinylacetate (PubChem CID 3549748) has the molecular formula C12H14N2O8S and a molecular weight of 346.32 g/mol. Its IUPAC name is 2-ethoxyethyl 2-(2,4-dinitrophenyl)sulfinylacetate.
| Compound Name | 2-ethoxyethyl 2-(2,4-dinitrophenyl)sulfinylacetate |
|---|---|
| PubChem CID | 3549748 |
| Molecular Formula | C12H14N2O8S |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-ethoxyethyl 2-(2,4-dinitrophenyl)sulfinylacetate |
| SMILES | CCOCCOC(=O)CS(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N2O8S/c1-2-21-5-6-22-12(15)8-23(20)11-4-3-9(13(16)17)7-10(11)14(18)19/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | HCWIJIHDOZVCDM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|