C22H26N2O7S — CID 5261832
(2,6-ditert-butylphenyl) 2-(2,4-dinitrophenyl)sulfinylacetate (PubChem CID 5261832) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is (2,6-ditert-butylphenyl) 2-(2,4-dinitrophenyl)sulfinylacetate.
| Compound Name | (2,6-ditert-butylphenyl) 2-(2,4-dinitrophenyl)sulfinylacetate |
|---|---|
| PubChem CID | 5261832 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (2,6-ditert-butylphenyl) 2-(2,4-dinitrophenyl)sulfinylacetate |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1OC(=O)CS(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26N2O7S/c1-21(2,3)15-8-7-9-16(22(4,5)6)20(15)31-19(25)13-32(30)18-11-10-14(23(26)27)12-17(18)24(28)29/h7-12H,13H2,1-6H3 |
| InChIKey | DDFADAYVNPFQNZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|