C11H14N2O5S — CID 154197608
2,4-dinitro-1-pentylsulfinylbenzene (PubChem CID 154197608) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2,4-dinitro-1-pentylsulfinylbenzene.
| Compound Name | 2,4-dinitro-1-pentylsulfinylbenzene |
|---|---|
| PubChem CID | 154197608 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2,4-dinitro-1-pentylsulfinylbenzene |
| SMILES | CCCCCS(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N2O5S/c1-2-3-4-7-19(18)11-6-5-9(12(14)15)8-10(11)13(16)17/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | CLARQPDSMSOEGF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|