C16H23NO5S — CID 138395464
2-(4-ethylsulfinyl-3-nitrophenyl)-2-pentyl-1,3-dioxolane (PubChem CID 138395464) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-(4-ethylsulfinyl-3-nitrophenyl)-2-pentyl-1,3-dioxolane.
| Compound Name | 2-(4-ethylsulfinyl-3-nitrophenyl)-2-pentyl-1,3-dioxolane |
|---|---|
| PubChem CID | 138395464 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-(4-ethylsulfinyl-3-nitrophenyl)-2-pentyl-1,3-dioxolane |
| SMILES | CCCCCC1(c2ccc(S(=O)CC)c([N+](=O)[O-])c2)OCCO1 |
| InChI | InChI=1S/C16H23NO5S/c1-3-5-6-9-16(21-10-11-22-16)13-7-8-15(23(20)4-2)14(12-13)17(18)19/h7-8,12H,3-6,9-11H2,1-2H3 |
| InChIKey | JGKGZLBGICBLAV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|