C17H25F3N2O3S — CID 19779481
N,N-diethyl-6-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylhexan-1-amine (PubChem CID 19779481) has the molecular formula C17H25F3N2O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is N,N-diethyl-6-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylhexan-1-amine.
| Compound Name | N,N-diethyl-6-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylhexan-1-amine |
|---|---|
| PubChem CID | 19779481 |
| Molecular Formula | C17H25F3N2O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N,N-diethyl-6-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylhexan-1-amine |
| SMILES | CCN(CC)CCCCCCS(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25F3N2O3S/c1-3-21(4-2)11-7-5-6-8-12-26(25)16-10-9-14(17(18,19)20)13-15(16)22(23)24/h9-10,13H,3-8,11-12H2,1-2H3 |
| InChIKey | WYSDQACDGPHNRL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|