C17H26F3N3O3S — CID 57253174
6-[amino-[2-nitro-4-(trifluoromethyl)phenyl]-oxo-λ6-sulfanylidene]-N,N-diethylhexan-1-amine (PubChem CID 57253174) has the molecular formula C17H26F3N3O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is 6-[amino-[2-nitro-4-(trifluoromethyl)phenyl]-oxo-λ6-sulfanylidene]-N,N-diethylhexan-1-amine.
| Compound Name | 6-[amino-[2-nitro-4-(trifluoromethyl)phenyl]-oxo-λ6-sulfanylidene]-N,N-diethylhexan-1-amine |
|---|---|
| PubChem CID | 57253174 |
| Molecular Formula | C17H26F3N3O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 6-[amino-[2-nitro-4-(trifluoromethyl)phenyl]-oxo-λ6-sulfanylidene]-N,N-diethylhexan-1-amine |
| SMILES | CCN(CC)CCCCCC=S(N)(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26F3N3O3S/c1-3-22(4-2)11-7-5-6-8-12-27(21,26)16-10-9-14(17(18,19)20)13-15(16)23(24)25/h9-10,12-13H,3-8,11H2,1-2H3,(H2,21,26) |
| InChIKey | SIQNNCLYXGPKPF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|