C17H11N3O7S — CID 5261830
quinolin-8-yl 2-(2,4-dinitrophenyl)sulfinylacetate (PubChem CID 5261830) has the molecular formula C17H11N3O7S and a molecular weight of 401.36 g/mol. Its IUPAC name is quinolin-8-yl 2-(2,4-dinitrophenyl)sulfinylacetate.
| Compound Name | quinolin-8-yl 2-(2,4-dinitrophenyl)sulfinylacetate |
|---|---|
| PubChem CID | 5261830 |
| Molecular Formula | C17H11N3O7S |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | quinolin-8-yl 2-(2,4-dinitrophenyl)sulfinylacetate |
| SMILES | O=C(CS(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])Oc1cccc2cccnc12 |
| InChI | InChI=1S/C17H11N3O7S/c21-16(27-14-5-1-3-11-4-2-8-18-17(11)14)10-28(26)15-7-6-12(19(22)23)9-13(15)20(24)25/h1-9H,10H2 |
| InChIKey | IPKCNBOLTKRIJK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 142.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|