C11H13BrN2O6S — CID 155123526
4-bromobutyl N-(2-nitrophenyl)sulfonylcarbamate (PubChem CID 155123526) has the molecular formula C11H13BrN2O6S and a molecular weight of 381.20 g/mol. Its IUPAC name is 4-bromobutyl N-(2-nitrophenyl)sulfonylcarbamate.
| Compound Name | 4-bromobutyl N-(2-nitrophenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 155123526 |
| Molecular Formula | C11H13BrN2O6S |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 4-bromobutyl N-(2-nitrophenyl)sulfonylcarbamate |
| SMILES | O=C(NS(=O)(=O)c1ccccc1[N+](=O)[O-])OCCCCBr |
| InChI | InChI=1S/C11H13BrN2O6S/c12-7-3-4-8-20-11(15)13-21(18,19)10-6-2-1-5-9(10)14(16)17/h1-2,5-6H,3-4,7-8H2,(H,13,15) |
| InChIKey | BLBNYVJTRLWGRN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|