C13H17N3O6S — CID 10497545
prop-2-enyl N-[3-[(2-nitrophenyl)sulfonylamino]propyl]carbamate (PubChem CID 10497545) has the molecular formula C13H17N3O6S and a molecular weight of 343.36 g/mol. Its IUPAC name is prop-2-enyl N-[3-[(2-nitrophenyl)sulfonylamino]propyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[(2-nitrophenyl)sulfonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 10497545 |
| Molecular Formula | C13H17N3O6S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | prop-2-enyl N-[3-[(2-nitrophenyl)sulfonylamino]propyl]carbamate |
| SMILES | C=CCOC(=O)NCCCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N3O6S/c1-2-10-22-13(17)14-8-5-9-15-23(20,21)12-7-4-3-6-11(12)16(18)19/h2-4,6-7,15H,1,5,8-10H2,(H,14,17) |
| InChIKey | INKIDQWOEVNHHA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|