C23H21FN4O5 — CID 26420522
2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(2-nitroanilino)ethyl]benzamide (PubChem CID 26420522) has the molecular formula C23H21FN4O5 and a molecular weight of 452.44 g/mol. Its IUPAC name is 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(2-nitroanilino)ethyl]benzamide.
| Compound Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(2-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 26420522 |
| Molecular Formula | C23H21FN4O5 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(2-nitroanilino)ethyl]benzamide |
| SMILES | O=C(COc1ccccc1C(=O)NCCNc1ccccc1[N+](=O)[O-])Nc1ccccc1F |
| InChI | InChI=1S/C23H21FN4O5/c24-17-8-2-3-9-18(17)27-22(29)15-33-21-12-6-1-7-16(21)23(30)26-14-13-25-19-10-4-5-11-20(19)28(31)32/h1-12,25H,13-15H2,(H,26,30)(H,27,29) |
| InChIKey | KLNDKBLLIKSOJB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|