C19H19FN2O3 — CID 34822016
N-(cyclopropylmethyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide (PubChem CID 34822016) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-(cyclopropylmethyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 34822016 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-(cyclopropylmethyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
| SMILES | O=C(COc1ccccc1C(=O)NCC1CC1)Nc1ccccc1F |
| InChI | InChI=1S/C19H19FN2O3/c20-15-6-2-3-7-16(15)22-18(23)12-25-17-8-4-1-5-14(17)19(24)21-11-13-9-10-13/h1-8,13H,9-12H2,(H,21,24)(H,22,23) |
| InChIKey | XXXZHPORYLWQEJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |