C24H23FN2O5 — CID 27173831
2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(4-methoxyphenoxy)ethyl]benzamide (PubChem CID 27173831) has the molecular formula C24H23FN2O5 and a molecular weight of 438.46 g/mol. Its IUPAC name is 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(4-methoxyphenoxy)ethyl]benzamide.
| Compound Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(4-methoxyphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 27173831 |
| Molecular Formula | C24H23FN2O5 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(4-methoxyphenoxy)ethyl]benzamide |
| SMILES | COc1ccc(OCCNC(=O)c2ccccc2OCC(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C24H23FN2O5/c1-30-17-10-12-18(13-11-17)31-15-14-26-24(29)19-6-2-5-9-22(19)32-16-23(28)27-21-8-4-3-7-20(21)25/h2-13H,14-16H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | AZLWSQXPUONSOA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|