C27H29FN2O5 — CID 55765507
N-[(4-butoxy-3-methoxyphenyl)methyl]-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide (PubChem CID 55765507) has the molecular formula C27H29FN2O5 and a molecular weight of 480.54 g/mol. Its IUPAC name is N-[(4-butoxy-3-methoxyphenyl)methyl]-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-[(4-butoxy-3-methoxyphenyl)methyl]-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 55765507 |
| Molecular Formula | C27H29FN2O5 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | N-[(4-butoxy-3-methoxyphenyl)methyl]-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
| SMILES | CCCCOc1ccc(CNC(=O)c2ccccc2OCC(=O)Nc2ccccc2F)cc1OC |
| InChI | InChI=1S/C27H29FN2O5/c1-3-4-15-34-24-14-13-19(16-25(24)33-2)17-29-27(32)20-9-5-8-12-23(20)35-18-26(31)30-22-11-7-6-10-21(22)28/h5-14,16H,3-4,15,17-18H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | UBBMZOXBNZFSHS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|