C25H25FN2O4 — CID 26457178
2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide (PubChem CID 26457178) has the molecular formula C25H25FN2O4 and a molecular weight of 436.48 g/mol. Its IUPAC name is 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide.
| Compound Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 26457178 |
| Molecular Formula | C25H25FN2O4 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[2-(2-methoxy-5-methylphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C)cc1CCNC(=O)c1ccccc1OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C25H25FN2O4/c1-17-11-12-22(31-2)18(15-17)13-14-27-25(30)19-7-3-6-10-23(19)32-16-24(29)28-21-9-5-4-8-20(21)26/h3-12,15H,13-14,16H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | FWBUPCDANJRZPU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |