C23H20ClFN2O4 — CID 78887246
N-[(5-chloro-2-methoxyphenyl)methyl]-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide (PubChem CID 78887246) has the molecular formula C23H20ClFN2O4 and a molecular weight of 442.87 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 78887246 |
| Molecular Formula | C23H20ClFN2O4 |
| Molecular Weight | 442.87 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
| SMILES | COc1ccc(Cl)cc1CNC(=O)c1ccccc1OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C23H20ClFN2O4/c1-30-20-11-10-16(24)12-15(20)13-26-23(29)17-6-2-5-9-21(17)31-14-22(28)27-19-8-4-3-7-18(19)25/h2-12H,13-14H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | ASXKRRWWLDZODZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.87 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |