C23H18F4N2O3 — CID 55340991
2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 55340991) has the molecular formula C23H18F4N2O3 and a molecular weight of 446.40 g/mol. Its IUPAC name is 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55340991 |
| Molecular Formula | C23H18F4N2O3 |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(COc1ccccc1C(=O)NCc1cccc(C(F)(F)F)c1)Nc1ccccc1F |
| InChI | InChI=1S/C23H18F4N2O3/c24-18-9-2-3-10-19(18)29-21(30)14-32-20-11-4-1-8-17(20)22(31)28-13-15-6-5-7-16(12-15)23(25,26)27/h1-12H,13-14H2,(H,28,31)(H,29,30) |
| InChIKey | ZDKSVAFFLZUTCZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |