C16H13ClF3NO2 — CID 8871375
2-(2-chlorophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 8871375) has the molecular formula C16H13ClF3NO2 and a molecular weight of 343.73 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 8871375 |
| Molecular Formula | C16H13ClF3NO2 |
| Molecular Weight | 343.73 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13ClF3NO2/c17-13-6-1-2-7-14(13)23-10-15(22)21-9-11-4-3-5-12(8-11)16(18,19)20/h1-8H,9-10H2,(H,21,22) |
| InChIKey | ZTAUBGDQYGWDOE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.73 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |