C17H13ClF3NO3 — CID 46860400
[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl] 4-chlorobenzoate (PubChem CID 46860400) has the molecular formula C17H13ClF3NO3 and a molecular weight of 371.74 g/mol. Its IUPAC name is [2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl] 4-chlorobenzoate.
| Compound Name | [2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 46860400 |
| Molecular Formula | C17H13ClF3NO3 |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | [2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl] 4-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)cc1)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13ClF3NO3/c18-14-6-4-12(5-7-14)16(24)25-10-15(23)22-9-11-2-1-3-13(8-11)17(19,20)21/h1-8H,9-10H2,(H,22,23) |
| InChIKey | LPEQIFVPBFQEEY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |