C21H15F3N2O3 — CID 26360256
N-(2,4-difluorophenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide (PubChem CID 26360256) has the molecular formula C21H15F3N2O3 and a molecular weight of 400.36 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 26360256 |
| Molecular Formula | C21H15F3N2O3 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
| SMILES | O=C(COc1ccccc1C(=O)Nc1ccc(F)cc1F)Nc1ccccc1F |
| InChI | InChI=1S/C21H15F3N2O3/c22-13-9-10-18(16(24)11-13)26-21(28)14-5-1-4-8-19(14)29-12-20(27)25-17-7-3-2-6-15(17)23/h1-11H,12H2,(H,25,27)(H,26,28) |
| InChIKey | GQPMKIMPDZUNQJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |