C22H16FN3O3 — CID 26727992
N-(3-cyanophenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide (PubChem CID 26727992) has the molecular formula C22H16FN3O3 and a molecular weight of 389.39 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-(3-cyanophenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 26727992 |
| Molecular Formula | C22H16FN3O3 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-(3-cyanophenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
| SMILES | N#Cc1cccc(NC(=O)c2ccccc2OCC(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C22H16FN3O3/c23-18-9-2-3-10-19(18)26-21(27)14-29-20-11-4-1-8-17(20)22(28)25-16-7-5-6-15(12-16)13-24/h1-12H,14H2,(H,25,28)(H,26,27) |
| InChIKey | IWYVKXUJZILVII-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |