C26H23FN4O4 — CID 55880459
2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[3-(2-pyrazol-1-ylethoxy)phenyl]benzamide (PubChem CID 55880459) has the molecular formula C26H23FN4O4 and a molecular weight of 474.49 g/mol. Its IUPAC name is 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[3-(2-pyrazol-1-ylethoxy)phenyl]benzamide.
| Compound Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[3-(2-pyrazol-1-ylethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 55880459 |
| Molecular Formula | C26H23FN4O4 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[3-(2-pyrazol-1-ylethoxy)phenyl]benzamide |
| SMILES | O=C(COc1ccccc1C(=O)Nc1cccc(OCCn2cccn2)c1)Nc1ccccc1F |
| InChI | InChI=1S/C26H23FN4O4/c27-22-10-2-3-11-23(22)30-25(32)18-35-24-12-4-1-9-21(24)26(33)29-19-7-5-8-20(17-19)34-16-15-31-14-6-13-28-31/h1-14,17H,15-16,18H2,(H,29,33)(H,30,32) |
| InChIKey | KUGORKZHJOYPRZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |