C24H21N3O2 — CID 55767479
4-phenyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]benzamide (PubChem CID 55767479) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-phenyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]benzamide.
| Compound Name | 4-phenyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 55767479 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 4-phenyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(OCCn2cccn2)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O2/c28-24(21-12-10-20(11-13-21)19-6-2-1-3-7-19)26-22-8-4-9-23(18-22)29-17-16-27-15-5-14-25-27/h1-15,18H,16-17H2,(H,26,28) |
| InChIKey | GXJZLJMZYWPZJH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |