C27H26FN3O5 — CID 46436775
2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[3-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]benzamide (PubChem CID 46436775) has the molecular formula C27H26FN3O5 and a molecular weight of 491.52 g/mol. Its IUPAC name is 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[3-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]benzamide.
| Compound Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[3-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 46436775 |
| Molecular Formula | C27H26FN3O5 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-[3-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]benzamide |
| SMILES | O=C(COc1ccccc1C(=O)Nc1cccc(OCC(=O)N2CCCC2)c1)Nc1ccccc1F |
| InChI | InChI=1S/C27H26FN3O5/c28-22-11-2-3-12-23(22)30-25(32)17-36-24-13-4-1-10-21(24)27(34)29-19-8-7-9-20(16-19)35-18-26(33)31-14-5-6-15-31/h1-4,7-13,16H,5-6,14-15,17-18H2,(H,29,34)(H,30,32) |
| InChIKey | JWSGDEAEDFLIKR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |