C26H26FN3O3 — CID 26289744
2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-(4-piperidin-1-ylphenyl)benzamide (PubChem CID 26289744) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-(4-piperidin-1-ylphenyl)benzamide.
| Compound Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-(4-piperidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 26289744 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]-N-(4-piperidin-1-ylphenyl)benzamide |
| SMILES | O=C(COc1ccccc1C(=O)Nc1ccc(N2CCCCC2)cc1)Nc1ccccc1F |
| InChI | InChI=1S/C26H26FN3O3/c27-22-9-3-4-10-23(22)29-25(31)18-33-24-11-5-2-8-21(24)26(32)28-19-12-14-20(15-13-19)30-16-6-1-7-17-30/h2-5,8-15H,1,6-7,16-18H2,(H,28,32)(H,29,31) |
| InChIKey | CUMRJJAFZRBVPE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|