C25H25N3O3 — CID 67124692
N-[2-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethoxy]phenyl]benzamide (PubChem CID 67124692) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[2-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethoxy]phenyl]benzamide.
| Compound Name | N-[2-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 67124692 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[2-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethoxy]phenyl]benzamide |
| SMILES | O=C(COc1ccccc1NC(=O)c1ccccc1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C25H25N3O3/c29-24(26-20-12-14-21(15-13-20)28-16-6-7-17-28)18-31-23-11-5-4-10-22(23)27-25(30)19-8-2-1-3-9-19/h1-5,8-15H,6-7,16-18H2,(H,26,29)(H,27,30) |
| InChIKey | NGFWLPKAKZPLRP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|