C33H35NO4S — CID 110165969
N-(4-tert-butylphenyl)sulfonyl-4-(2-ethoxyphenyl)-2-(2-phenylethyl)benzamide (PubChem CID 110165969) has the molecular formula C33H35NO4S and a molecular weight of 541.71 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)sulfonyl-4-(2-ethoxyphenyl)-2-(2-phenylethyl)benzamide.
| Compound Name | N-(4-tert-butylphenyl)sulfonyl-4-(2-ethoxyphenyl)-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 110165969 |
| Molecular Formula | C33H35NO4S |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | N-(4-tert-butylphenyl)sulfonyl-4-(2-ethoxyphenyl)-2-(2-phenylethyl)benzamide |
| SMILES | CCOc1ccccc1-c1ccc(C(=O)NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(CCc2ccccc2)c1 |
| InChI | InChI=1S/C33H35NO4S/c1-5-38-31-14-10-9-13-29(31)25-17-22-30(26(23-25)16-15-24-11-7-6-8-12-24)32(35)34-39(36,37)28-20-18-27(19-21-28)33(2,3)4/h6-14,17-23H,5,15-16H2,1-4H3,(H,34,35) |
| InChIKey | ZOPHNIGZEMAQPQ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |