C29H26BrNO4S — CID 110166007
N-(4-bromophenyl)sulfonyl-4-(2-ethoxyphenyl)-2-(2-phenylethyl)benzamide (PubChem CID 110166007) has the molecular formula C29H26BrNO4S and a molecular weight of 564.50 g/mol. Its IUPAC name is N-(4-bromophenyl)sulfonyl-4-(2-ethoxyphenyl)-2-(2-phenylethyl)benzamide.
| Compound Name | N-(4-bromophenyl)sulfonyl-4-(2-ethoxyphenyl)-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 110166007 |
| Molecular Formula | C29H26BrNO4S |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | N-(4-bromophenyl)sulfonyl-4-(2-ethoxyphenyl)-2-(2-phenylethyl)benzamide |
| SMILES | CCOc1ccccc1-c1ccc(C(=O)NS(=O)(=O)c2ccc(Br)cc2)c(CCc2ccccc2)c1 |
| InChI | InChI=1S/C29H26BrNO4S/c1-2-35-28-11-7-6-10-26(28)22-14-19-27(23(20-22)13-12-21-8-4-3-5-9-21)29(32)31-36(33,34)25-17-15-24(30)16-18-25/h3-11,14-20H,2,12-13H2,1H3,(H,31,32) |
| InChIKey | ZOIUBIHKTHDYRF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |