C22H20BrNO6S2 — CID 110161798
2-[(4-bromophenyl)methoxy]-4-methyl-N-(4-methylsulfonylphenyl)sulfonylbenzamide (PubChem CID 110161798) has the molecular formula C22H20BrNO6S2 and a molecular weight of 538.44 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methoxy]-4-methyl-N-(4-methylsulfonylphenyl)sulfonylbenzamide.
| Compound Name | 2-[(4-bromophenyl)methoxy]-4-methyl-N-(4-methylsulfonylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 110161798 |
| Molecular Formula | C22H20BrNO6S2 |
| Molecular Weight | 538.44 g/mol |
| Exact Mass | 536.99 |
| IUPAC Name | 2-[(4-bromophenyl)methoxy]-4-methyl-N-(4-methylsulfonylphenyl)sulfonylbenzamide |
| SMILES | Cc1ccc(C(=O)NS(=O)(=O)c2ccc(S(C)(=O)=O)cc2)c(OCc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C22H20BrNO6S2/c1-15-3-12-20(21(13-15)30-14-16-4-6-17(23)7-5-16)22(25)24-32(28,29)19-10-8-18(9-11-19)31(2,26)27/h3-13H,14H2,1-2H3,(H,24,25) |
| InChIKey | AGARMJZUKMTDRZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |