C18H20BrNO5S — CID 166182044
2-(4-bromophenyl)-N-(3,4-diethoxyphenyl)sulfonylacetamide (PubChem CID 166182044) has the molecular formula C18H20BrNO5S and a molecular weight of 442.33 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(3,4-diethoxyphenyl)sulfonylacetamide.
| Compound Name | 2-(4-bromophenyl)-N-(3,4-diethoxyphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 166182044 |
| Molecular Formula | C18H20BrNO5S |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 2-(4-bromophenyl)-N-(3,4-diethoxyphenyl)sulfonylacetamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(=O)Cc2ccc(Br)cc2)cc1OCC |
| InChI | InChI=1S/C18H20BrNO5S/c1-3-24-16-10-9-15(12-17(16)25-4-2)26(22,23)20-18(21)11-13-5-7-14(19)8-6-13/h5-10,12H,3-4,11H2,1-2H3,(H,20,21) |
| InChIKey | XICZXLWTYCLGSV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |