C16H13BrN2O3S2 — CID 155967365
2-(4-bromophenyl)-N-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]acetamide (PubChem CID 155967365) has the molecular formula C16H13BrN2O3S2 and a molecular weight of 425.33 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]acetamide |
|---|---|
| PubChem CID | 155967365 |
| Molecular Formula | C16H13BrN2O3S2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]acetamide |
| SMILES | Cc1nc2ccc(S(=O)(=O)NC(=O)Cc3ccc(Br)cc3)cc2s1 |
| InChI | InChI=1S/C16H13BrN2O3S2/c1-10-18-14-7-6-13(9-15(14)23-10)24(21,22)19-16(20)8-11-2-4-12(17)5-3-11/h2-7,9H,8H2,1H3,(H,19,20) |
| InChIKey | QPEPRAAJQFGKRN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |