C15H13BrClNO4S — CID 166199698
N-(3-bromo-4-methoxyphenyl)sulfonyl-2-(4-chlorophenyl)acetamide (PubChem CID 166199698) has the molecular formula C15H13BrClNO4S and a molecular weight of 418.70 g/mol. Its IUPAC name is N-(3-bromo-4-methoxyphenyl)sulfonyl-2-(4-chlorophenyl)acetamide.
| Compound Name | N-(3-bromo-4-methoxyphenyl)sulfonyl-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 166199698 |
| Molecular Formula | C15H13BrClNO4S |
| Molecular Weight | 418.70 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | N-(3-bromo-4-methoxyphenyl)sulfonyl-2-(4-chlorophenyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)Cc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C15H13BrClNO4S/c1-22-14-7-6-12(9-13(14)16)23(20,21)18-15(19)8-10-2-4-11(17)5-3-10/h2-7,9H,8H2,1H3,(H,18,19) |
| InChIKey | WWMDKIDYMZQTGP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |