C18H20ClNO5S — CID 110357937
2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyphenyl)sulfonylethyl]acetamide (PubChem CID 110357937) has the molecular formula C18H20ClNO5S and a molecular weight of 397.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyphenyl)sulfonylethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyphenyl)sulfonylethyl]acetamide |
|---|---|
| PubChem CID | 110357937 |
| Molecular Formula | C18H20ClNO5S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyphenyl)sulfonylethyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)CCNC(=O)Cc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C18H20ClNO5S/c1-24-16-8-7-15(12-17(16)25-2)26(22,23)10-9-20-18(21)11-13-3-5-14(19)6-4-13/h3-8,12H,9-11H2,1-2H3,(H,20,21) |
| InChIKey | APSHNJPVUPDBOS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |