C16H16ClNO4S — CID 47038015
N-[2-(benzenesulfonyl)ethyl]-5-chloro-2-methoxybenzamide (PubChem CID 47038015) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethyl]-5-chloro-2-methoxybenzamide.
| Compound Name | N-[2-(benzenesulfonyl)ethyl]-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 47038015 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethyl]-5-chloro-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO4S/c1-22-15-8-7-12(17)11-14(15)16(19)18-9-10-23(20,21)13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,18,19) |
| InChIKey | UWQHCBSZNLVNHV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |