C15H22ClN3O3 — CID 108572238
5-chloro-N-[2-(diethylcarbamoylamino)ethyl]-2-methoxybenzamide (PubChem CID 108572238) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is 5-chloro-N-[2-(diethylcarbamoylamino)ethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[2-(diethylcarbamoylamino)ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 108572238 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-chloro-N-[2-(diethylcarbamoylamino)ethyl]-2-methoxybenzamide |
| SMILES | CCN(CC)C(=O)NCCNC(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C15H22ClN3O3/c1-4-19(5-2)15(21)18-9-8-17-14(20)12-10-11(16)6-7-13(12)22-3/h6-7,10H,4-5,8-9H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | LAYDCFCYWNJXKX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|