C18H17Cl3N2O4 — CID 108572251
3,6-dichloro-N-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-methoxybenzamide (PubChem CID 108572251) has the molecular formula C18H17Cl3N2O4 and a molecular weight of 431.70 g/mol. Its IUPAC name is 3,6-dichloro-N-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-methoxybenzamide.
| Compound Name | 3,6-dichloro-N-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 108572251 |
| Molecular Formula | C18H17Cl3N2O4 |
| Molecular Weight | 431.70 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 3,6-dichloro-N-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCNC(=O)c1c(Cl)ccc(Cl)c1OC |
| InChI | InChI=1S/C18H17Cl3N2O4/c1-26-14-6-3-10(19)9-11(14)17(24)22-7-8-23-18(25)15-12(20)4-5-13(21)16(15)27-2/h3-6,9H,7-8H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | YUZWTWRMZKFXJF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.70 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|