C20H24BrNO6S — CID 55434640
methyl 3-(4-bromophenyl)-3-[(3,4-diethoxyphenyl)sulfonylamino]propanoate (PubChem CID 55434640) has the molecular formula C20H24BrNO6S and a molecular weight of 486.38 g/mol. Its IUPAC name is methyl 3-(4-bromophenyl)-3-[(3,4-diethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 3-(4-bromophenyl)-3-[(3,4-diethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55434640 |
| Molecular Formula | C20H24BrNO6S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | methyl 3-(4-bromophenyl)-3-[(3,4-diethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCOc1ccc(S(=O)(=O)NC(CC(=O)OC)c2ccc(Br)cc2)cc1OCC |
| InChI | InChI=1S/C20H24BrNO6S/c1-4-27-18-11-10-16(12-19(18)28-5-2)29(24,25)22-17(13-20(23)26-3)14-6-8-15(21)9-7-14/h6-12,17,22H,4-5,13H2,1-3H3 |
| InChIKey | HKDVYXDWDBNOAU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |