C16H14N6O5S — CID 13103094
1-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-(8-nitronaphthalen-1-yl)sulfonylurea (PubChem CID 13103094) has the molecular formula C16H14N6O5S and a molecular weight of 402.39 g/mol. Its IUPAC name is 1-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-(8-nitronaphthalen-1-yl)sulfonylurea.
| Compound Name | 1-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-(8-nitronaphthalen-1-yl)sulfonylurea |
|---|---|
| PubChem CID | 13103094 |
| Molecular Formula | C16H14N6O5S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 1-(4,6-dimethyl-1,3,5-triazin-2-yl)-3-(8-nitronaphthalen-1-yl)sulfonylurea |
| SMILES | Cc1nc(C)nc(NC(=O)NS(=O)(=O)c2cccc3cccc([N+](=O)[O-])c23)n1 |
| InChI | InChI=1S/C16H14N6O5S/c1-9-17-10(2)19-15(18-9)20-16(23)21-28(26,27)13-8-4-6-11-5-3-7-12(14(11)13)22(24)25/h3-8H,1-2H3,(H2,17,18,19,20,21,23) |
| InChIKey | DLXVVKCJCMTHJX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 157.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|