C13H13N5O5S — CID 19812309
methyl 2-[(4-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate (PubChem CID 19812309) has the molecular formula C13H13N5O5S and a molecular weight of 351.34 g/mol. Its IUPAC name is methyl 2-[(4-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate.
| Compound Name | methyl 2-[(4-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 19812309 |
| Molecular Formula | C13H13N5O5S |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | methyl 2-[(4-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1ncnc(C)n1 |
| InChI | InChI=1S/C13H13N5O5S/c1-8-14-7-15-12(16-8)17-13(20)18-24(21,22)10-6-4-3-5-9(10)11(19)23-2/h3-7H,1-2H3,(H2,14,15,16,17,18,20) |
| InChIKey | XJBMUHFCPILCRS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |