C13H12N4O5S — CID 13176579
methyl 2-(pyrimidin-2-ylcarbamoylsulfamoyl)benzoate (PubChem CID 13176579) has the molecular formula C13H12N4O5S and a molecular weight of 336.33 g/mol. Its IUPAC name is methyl 2-(pyrimidin-2-ylcarbamoylsulfamoyl)benzoate.
| Compound Name | methyl 2-(pyrimidin-2-ylcarbamoylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 13176579 |
| Molecular Formula | C13H12N4O5S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | methyl 2-(pyrimidin-2-ylcarbamoylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1ncccn1 |
| InChI | InChI=1S/C13H12N4O5S/c1-22-11(18)9-5-2-3-6-10(9)23(20,21)17-13(19)16-12-14-7-4-8-15-12/h2-8H,1H3,(H2,14,15,16,17,19) |
| InChIKey | UCSUWTAHNYRQFL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |