C15H16N4O5S — CID 13176760
methyl 2-[(2,6-dimethylpyrimidin-4-yl)carbamoylsulfamoyl]benzoate (PubChem CID 13176760) has the molecular formula C15H16N4O5S and a molecular weight of 364.38 g/mol. Its IUPAC name is methyl 2-[(2,6-dimethylpyrimidin-4-yl)carbamoylsulfamoyl]benzoate.
| Compound Name | methyl 2-[(2,6-dimethylpyrimidin-4-yl)carbamoylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 13176760 |
| Molecular Formula | C15H16N4O5S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | methyl 2-[(2,6-dimethylpyrimidin-4-yl)carbamoylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1cc(C)nc(C)n1 |
| InChI | InChI=1S/C15H16N4O5S/c1-9-8-13(17-10(2)16-9)18-15(21)19-25(22,23)12-7-5-4-6-11(12)14(20)24-3/h4-8H,1-3H3,(H2,16,17,18,19,21) |
| InChIKey | QVBXVDYJSSFBNG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |