C12H13NO7S — CID 101190058
4-[(2-methoxycarbonylphenyl)sulfonylamino]-4-oxobutanoic acid (PubChem CID 101190058) has the molecular formula C12H13NO7S and a molecular weight of 315.30 g/mol. Its IUPAC name is 4-[(2-methoxycarbonylphenyl)sulfonylamino]-4-oxobutanoic acid.
| Compound Name | 4-[(2-methoxycarbonylphenyl)sulfonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 101190058 |
| Molecular Formula | C12H13NO7S |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 4-[(2-methoxycarbonylphenyl)sulfonylamino]-4-oxobutanoic acid |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C12H13NO7S/c1-20-12(17)8-4-2-3-5-9(8)21(18,19)13-10(14)6-7-11(15)16/h2-5H,6-7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | HJAZSISKGUXHLL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |