C27H27AsN9O12S2 — CID 88509322
CID 88509322 (PubChem CID 88509322) has the molecular formula C27H27AsN9O12S2 and a molecular weight of 808.62 g/mol.
| Compound Name | CID 88509322 |
|---|---|
| PubChem CID | 88509322 |
| Molecular Formula | C27H27AsN9O12S2 |
| Molecular Weight | 808.62 g/mol |
| Exact Mass | 808.04 |
| IUPAC Name | — |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(C)nc(OC)n1.COc1nc(C)nc([As]C(=O)NS(=O)(=O)c2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C14H15N5O6S.C13H12AsN4O6S/c1-8-15-12(18-14(16-8)25-3)17-13(21)19-26(22,23)10-7-5-4-6-9(10)11(20)24-2;1-7-15-11(17-13(16-7)24-2)14-12(21)18-25(22,23)9-6-4-3-5-8(9)10(19)20/h4-7H,1-3H3,(H2,15,16,17,18,19,21);3-6H,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | IONBRPRNLAKAKB-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 297.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.62 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|