C17H16N6O5S — CID 23044833
1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-3-[(3-phenyl-2-pyridinyl)sulfonyl]urea (PubChem CID 23044833) has the molecular formula C17H16N6O5S and a molecular weight of 416.42 g/mol. Its IUPAC name is 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-3-[(3-phenyl-2-pyridinyl)sulfonyl]urea.
| Compound Name | 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-3-[(3-phenyl-2-pyridinyl)sulfonyl]urea |
|---|---|
| PubChem CID | 23044833 |
| Molecular Formula | C17H16N6O5S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-3-[(3-phenyl-2-pyridinyl)sulfonyl]urea |
| SMILES | COc1nc(NC(=O)NS(=O)(=O)c2ncccc2-c2ccccc2)nc(OC)n1 |
| InChI | InChI=1S/C17H16N6O5S/c1-27-16-20-14(21-17(22-16)28-2)19-15(24)23-29(25,26)13-12(9-6-10-18-13)11-7-4-3-5-8-11/h3-10H,1-2H3,(H2,19,20,21,22,23,24) |
| InChIKey | HQPXMZGQNUMDOO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 145.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |