C19H19N5O4S2 — CID 13422025
methyl N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-N'-(2-phenylphenyl)sulfonylcarbamimidothioate (PubChem CID 13422025) has the molecular formula C19H19N5O4S2 and a molecular weight of 445.53 g/mol. Its IUPAC name is methyl N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-N'-(2-phenylphenyl)sulfonylcarbamimidothioate.
| Compound Name | methyl N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-N'-(2-phenylphenyl)sulfonylcarbamimidothioate |
|---|---|
| PubChem CID | 13422025 |
| Molecular Formula | C19H19N5O4S2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | methyl N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-N'-(2-phenylphenyl)sulfonylcarbamimidothioate |
| SMILES | COc1nc(N/C(=N/S(=O)(=O)c2ccccc2-c2ccccc2)SC)nc(OC)n1 |
| InChI | InChI=1S/C19H19N5O4S2/c1-27-17-20-16(21-18(23-17)28-2)22-19(29-3)24-30(25,26)15-12-8-7-11-14(15)13-9-5-4-6-10-13/h4-12H,1-3H3,(H,20,21,22,23,24) |
| InChIKey | UNWOEOIOMASULH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|