C14H14N2O2S2 — CID 56625383
methyl N'-(benzenesulfonyl)-N-phenylcarbamimidothioate (PubChem CID 56625383) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is methyl N'-(benzenesulfonyl)-N-phenylcarbamimidothioate.
| Compound Name | methyl N'-(benzenesulfonyl)-N-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 56625383 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | methyl N'-(benzenesulfonyl)-N-phenylcarbamimidothioate |
| SMILES | CSC(=NS(=O)(=O)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C14H14N2O2S2/c1-19-14(15-12-8-4-2-5-9-12)16-20(17,18)13-10-6-3-7-11-13/h2-11H,1H3,(H,15,16) |
| InChIKey | MHSKPUNWRHBUNI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|