C18H22N4O2S3 — CID 54598625
methyl N'-(benzenesulfonyl)-N-[(4-propan-2-ylphenyl)carbamothioylamino]carbamimidothioate (PubChem CID 54598625) has the molecular formula C18H22N4O2S3 and a molecular weight of 422.60 g/mol. Its IUPAC name is methyl N'-(benzenesulfonyl)-N-[(4-propan-2-ylphenyl)carbamothioylamino]carbamimidothioate.
| Compound Name | methyl N'-(benzenesulfonyl)-N-[(4-propan-2-ylphenyl)carbamothioylamino]carbamimidothioate |
|---|---|
| PubChem CID | 54598625 |
| Molecular Formula | C18H22N4O2S3 |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | methyl N'-(benzenesulfonyl)-N-[(4-propan-2-ylphenyl)carbamothioylamino]carbamimidothioate |
| SMILES | CS/C(=N/S(=O)(=O)c1ccccc1)NNC(=S)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C18H22N4O2S3/c1-13(2)14-9-11-15(12-10-14)19-17(25)20-21-18(26-3)22-27(23,24)16-7-5-4-6-8-16/h4-13H,1-3H3,(H,21,22)(H2,19,20,25) |
| InChIKey | DSKWDSMKAAHKLP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|